CAS 24034-22-8 appears in our catalog under these names: 2-Bromo-1-nitro-3-(trifluoromethyl)benzene, 98%, 2–Bromo–1–nitro–3–(trifluoromethyl)benzene. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g.
2-bromo-1-nitro-3-(trifluoromethyl)benzene (CAS 24034-22-8) is a chemical compound with the molecular formula C7H3BrF3NO2 and a molecular weight of 270.00 g/mol. IUPAC name: 2-bromo-1-nitro-3-(trifluoromethyl)benzene. InChIKey: DCGZVTANWJKOPM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | 2-bromo-1-nitro-3-(trifluoromethyl)benzene |
| InChIKey | DCGZVTANWJKOPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)C(F)(F)F |
Computed by PubChem (NCBI)