cas: 39774-26-0 — see every product listed under this CAS number, including other names
2-Bromo-6-phenylpyridine, >98.0%(GC) (CAS 39774-26-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B5150-200MG |
| cas | 39774-26-0 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 246.19 Pln | |
| TCI | 1g | 742.84 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-bromo-6-phenylpyridine (CAS 39774-26-0) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-6-phenylpyridine. InChIKey: XIYPPJVLAAXYAB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-6-phenylpyridine |
| InChIKey | XIYPPJVLAAXYAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)