cas: 39774-26-0 — see every product listed under this CAS number, including other names
2-Bromo-6-phenylpyridine, 95% (CAS 39774-26-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233243-1G |
| cas | 39774-26-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 10g | 1450.55 Pln | |
| Fluorochem | 25g | 2455.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-6-phenylpyridine (CAS 39774-26-0) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-6-phenylpyridine. InChIKey: XIYPPJVLAAXYAB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-6-phenylpyridine |
| InChIKey | XIYPPJVLAAXYAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)