cas: 39774-26-0 — see every product listed under this CAS number, including other names
2-Bromo-6-phenylpyridine, 97%, 97% (CAS 39774-26-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149RK-100mg |
| cas | 39774-26-0 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 25g | 2219.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-phenylpyridine (CAS 39774-26-0) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-6-phenylpyridine. InChIKey: XIYPPJVLAAXYAB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-6-phenylpyridine |
| InChIKey | XIYPPJVLAAXYAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)