cas: 106904-09-0 — see every product listed under this CAS number, including other names
2-CHLORO-3-METHYL-4-(METHYLSULFONYL)BENZOIC ACID, 98% (CAS 106904-09-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467271-250MG |
| cas | 106904-09-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1518.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-3-methyl-4-methylsulfonylbenzoic acid (CAS 106904-09-0) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 2-chloro-3-methyl-4-methylsulfonylbenzoic acid. InChIKey: RRFGGUXLGOVPOP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 2-chloro-3-methyl-4-methylsulfonylbenzoic acid |
| InChIKey | RRFGGUXLGOVPOP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)