Products 313346-23-5
CAS 313346-23-5 appears in our catalog under these names: 5–(Chlorosulfonyl)–2，4–dimethylbenzoic acid, 5-(Chlorosulfonyl)-2,4-dimethylbenzoic acid, 95%, 5-(Chlorosulfonyl)-2,4-dimethylbenzoic acid 95%, 5-(Chlorosulfonyl)-2,4-dimethylbenzoic acid, 96%, 5-(Chlorosulfonyl)-2,4-dimethylbenzoic acid, 96%, 96%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 25g, 100mg.
5-chlorosulfonyl-2,4-dimethylbenzoic acid (CAS 313346-23-5) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 5-chlorosulfonyl-2,4-dimethylbenzoic acid. InChIKey: FFRJDYMIRFLOCU-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 5-chlorosulfonyl-2,4-dimethylbenzoic acid |
| InChIKey | FFRJDYMIRFLOCU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)