Products 321309-38-0

CAS 321309-38-0 appears in our catalog under these names: 3,4-Dihydro-2h-1,5-benzodioxepine-7-sulfonyl chloride, 95%, 3,4-Dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 2,5g.

Structural formula: {0} (CAS {1})

3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride (CAS 321309-38-0) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride. InChIKey: ADAGPISZFDLGCR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO4S
Molecular weight248.68 g/mol
IUPAC name3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride
InChIKeyADAGPISZFDLGCR-UHFFFAOYSA-N
SMILESC1COC2=C(C=C(C=C2)S(=O)(=O)Cl)OC1

Computed by PubChem (NCBI)