CAS 321309-38-0 appears in our catalog under these names: 3,4-Dihydro-2h-1,5-benzodioxepine-7-sulfonyl chloride, 95%, 3,4-Dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 2,5g.
3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride (CAS 321309-38-0) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride. InChIKey: ADAGPISZFDLGCR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonyl chloride |
| InChIKey | ADAGPISZFDLGCR-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)S(=O)(=O)Cl)OC1 |
Computed by PubChem (NCBI)