CAS 866358-15-8 is the registry number for 3-(Chlorosulfonyl)-2,6-dimethylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-chlorosulfonyl-2,6-dimethylbenzoic acid (CAS 866358-15-8) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 3-chlorosulfonyl-2,6-dimethylbenzoic acid. InChIKey: DCYJDJUIRUWRNJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 3-chlorosulfonyl-2,6-dimethylbenzoic acid |
| InChIKey | DCYJDJUIRUWRNJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)C(=O)O |
Computed by PubChem (NCBI)