CAS 176309-00-5 appears in our catalog under these names: 4-Chloro-2-methyl-5-(methylsulfonyl)benzoic acid, 95%, 4-Chloro-2-methyl-5-(methylsulfonyl)-benzoic Acid, 4–Chloro–2–methyl–5–(methylsulfonyl)benzoic acid. Offered by: Combi-blocks, TRC, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 500mg.
4-chloro-2-methyl-5-methylsulfonylbenzoic acid (CAS 176309-00-5) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 4-chloro-2-methyl-5-methylsulfonylbenzoic acid. InChIKey: YGYZEHXIHONBML-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 4-chloro-2-methyl-5-methylsulfonylbenzoic acid |
| InChIKey | YGYZEHXIHONBML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)