CAS 103008-54-4 is the registry number for ethyl 2-(chlorosulfonyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 2-chlorosulfonylbenzoate (CAS 103008-54-4) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: ethyl 2-chlorosulfonylbenzoate. InChIKey: YYVLJSYHJIQREA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | ethyl 2-chlorosulfonylbenzoate |
| InChIKey | YYVLJSYHJIQREA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)