CAS 106904-09-0 appears in our catalog under these names: 2-Chloro-3-methyl-4-(methylsulfonyl)benzoic acid, 95%, 2–chloro–3–methyl–4–(methylsulfonyl)benzoic acid, 2-Chloro-3-methyl-4-(methylsulfonyl)benzoic acid 95%, 2-Chloro-3-methyl-4-(methylsulfonyl)benzoic acid, 95%, 95%, 2-CHLORO-3-METHYL-4-(METHYLSULFONYL)BENZOIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2-chloro-3-methyl-4-methylsulfonylbenzoic acid (CAS 106904-09-0) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 2-chloro-3-methyl-4-methylsulfonylbenzoic acid. InChIKey: RRFGGUXLGOVPOP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 2-chloro-3-methyl-4-methylsulfonylbenzoic acid |
| InChIKey | RRFGGUXLGOVPOP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)