Products 494751-92-7

CAS 494751-92-7 is the registry number for 3-(3-(Chlorosulfonyl)phenyl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-chlorosulfonylphenyl)propanoic acid (CAS 494751-92-7) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 3-(3-chlorosulfonylphenyl)propanoic acid. InChIKey: WEYGFADWOUDBBX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO4S
Molecular weight248.68 g/mol
IUPAC name3-(3-chlorosulfonylphenyl)propanoic acid
InChIKeyWEYGFADWOUDBBX-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)Cl)CCC(=O)O

Computed by PubChem (NCBI)