cas: 1214346-10-7 — see every product listed under this CAS number, including other names
2-Chloro-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 98% (CAS 1214346-10-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A936881-1g |
| cas | 1214346-10-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3416.14 Pln | |
| AmBeed | 5g | 11032.84 Pln | |
| Fluorochem | 250mg | 726.85 Pln | |
| Fluorochem | 1g | 2731.35 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 1214346-10-7) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 2-chloro-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: QHZPYQQXLBLSLZ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | QHZPYQQXLBLSLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)