CAS 875167-01-4 appears in our catalog under these names: 3-Chloro-5-trifluoromethylphenylsulfonyl chloride, 95%, 3-Chloro-5-(trifluoromethyl)benzene-1-sulfonyl chloride 98%, 3-CHLORO-5-TRIFLUOROMETHYLPHENYLSULFONYL CHLORIDE, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg.
3-chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS 875167-01-4) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: JYUGVORTFRFETG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | JYUGVORTFRFETG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)