CAS 32333-53-2 appears in our catalog under these names: 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride, 98%, 4–chloro–3–(trifluoromethyl)benzenesulfonylchloride, 4-Chloro-3-(trifluoromethyl)benzenesulfonyl Chloride, >98.0%(GC)(T), 4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride, 97% , 4-Chloro-3-(trifluoromethyl)benzenesulfonyl Chloride 98%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, 500g, 10g.
4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 32333-53-2) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: SSULGNXFUGLULI-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | SSULGNXFUGLULI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)