Products 54090-42-5

CAS 54090-42-5 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)benzene-1-sulfonyl chloride 95%, 4-Chloro-2-trifluoromethylbenzenesulfonyl chloride, ≥92%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 54090-42-5) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: DQKPVVIVMURTDM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2F3O2S
Molecular weight279.06 g/mol
IUPAC name4-chloro-2-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyDQKPVVIVMURTDM-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)