CAS 672-55-9 is the registry number for 3,4-Dichloro-1-(trifluoroMethylsulfonyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1,2-dichloro-4-(trifluoromethylsulfonyl)benzene (CAS 672-55-9) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 1,2-dichloro-4-(trifluoromethylsulfonyl)benzene. InChIKey: HEBGDAQEBUBEFL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 1,2-dichloro-4-(trifluoromethylsulfonyl)benzene |
| InChIKey | HEBGDAQEBUBEFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)