CAS 874814-70-7 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)benzene-1-sulfonyl chloride, 95%, 2-Chloro-6-(trifluoromethyl)benzenesulphonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
2-chloro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS 874814-70-7) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: CFRDWFNMFKQQBA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | CFRDWFNMFKQQBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)