CAS 175205-54-6 appears in our catalog under these names: 2–Chloro–4–(trifluoromethyl)benzenesulfonyl chloride, 2-Chloro-4-(trifluoromethyl)benzenesulfonyl Chloride, >98.0%(T), 2-Chloro-4-(trifluoromethyl)benzene-1-sulfonyl chloride, 97% , 2-Chloro-4-(trifluoromethyl)benzene-1-sulfonyl chloride 95%, 2-Chloro-4-(trifluoromethyl)benzenesulfonylchloride, 95%. Offered by: GLPBio, TCI, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g.
2-chloro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 175205-54-6) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: NJXDBSSSDPOAFI-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | NJXDBSSSDPOAFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)