CAS 54090-08-3 appears in our catalog under these names: 2–Chloro–5–(Trifluoromethyl)Benzenesulfonyl Chloride, 2-Chloro-5-(trifluoromethyl)benzene-1-sulfonyl chloride, 97% , 2-Chloro-5-(trifluoromethyl)benzene-1-sulfonyl chloride 98%, 2-Chloro-5-(trifluoromethyl)benzenesulfonylchloride, 97%. Offered by: GLPBio, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2-chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS 54090-08-3) is a chemical compound with the molecular formula C7H3Cl2F3O2S and a molecular weight of 279.06 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ZEYKLMDPUOVUCR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O2S |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | ZEYKLMDPUOVUCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)