2-Chloro-4,5-difluorobenzene-1-sulfonyl chloride, 95%
cas: 67475-58-5 — see every product listed under this CAS number, including other names
2-Chloro-4,5-difluorobenzene-1-sulfonyl chloride, 95% (CAS 67475-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A362674-1g |
| cas | 67475-58-5 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 1610.81 Pln | |
| Ambeed | 10g | 2562.00 Pln | |
| Ambeed | 25g | 5048.44 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 675.34 Pln | |
| BLDpharm | 5g | 1730.53 Pln | |
| BLDpharm | 10g | 2757.94 Pln | |
| BLDpharm | 25g | 5440.33 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-4,5-difluorobenzenesulfonyl chloride (CAS 67475-58-5) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 2-chloro-4,5-difluorobenzenesulfonyl chloride. InChIKey: NITODZKOCXPBBS-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2-chloro-4,5-difluorobenzenesulfonyl chloride |
| InChIKey | NITODZKOCXPBBS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)F)F |
Computed by PubChem (NCBI)
Synonyms:
2-chloro-4,5-difluorobenzenesulfonyl chloride, 2-chloro-4,5-difluorobenzene-1-sulfonyl chloride, 2-chloro-4,5-difluorobenzenesulphonyl chloride, 2-chloro-4,5-difluoro-benzenesulfonyl Chloride, Benzenesulfonyl chloride, 2-chloro-4,5-difluoro- (9CI), NITODZKOCXPBBS-UHFFFAOYSA-N, chloro(2-chloro-4,5-difluorophenyl)sulfone, 2-Chloro-45-difluorobenzenesulfonyl chloride, 2-chloro-4,5,-difluorobenzenesulfonyl chloride, 2-Chloro-4,5-difluorobenzene-1-sulfonylchloride