CAS 13656-57-0 is the registry number for 5-Chloro-2,4-difluorobenzenesulfonyl chloride, 96%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg.
5-chloro-2,4-difluorobenzenesulfonyl chloride (CAS 13656-57-0) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 5-chloro-2,4-difluorobenzenesulfonyl chloride. InChIKey: XMNXVDULKLCZFG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 5-chloro-2,4-difluorobenzenesulfonyl chloride |
| InChIKey | XMNXVDULKLCZFG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)