Products 1208078-24-3
CAS 1208078-24-3 is the registry number for 6-Chloro-2,3-difluorobenzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-2,3-difluorobenzenesulfonyl chloride (CAS 1208078-24-3) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 6-chloro-2,3-difluorobenzenesulfonyl chloride. InChIKey: WBXCGHIQPPUCPK-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 6-chloro-2,3-difluorobenzenesulfonyl chloride |
| InChIKey | WBXCGHIQPPUCPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)