CAS 1208074-71-8 is the registry number for 2-Chloro-3,6-difluorobenzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-3,6-difluorobenzenesulfonyl chloride (CAS 1208074-71-8) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 2-chloro-3,6-difluorobenzenesulfonyl chloride. InChIKey: XIBTVVMBHTYRAL-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2-chloro-3,6-difluorobenzenesulfonyl chloride |
| InChIKey | XIBTVVMBHTYRAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)