Products 1208074-71-8

CAS 1208074-71-8 is the registry number for 2-Chloro-3,6-difluorobenzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-chloro-3,6-difluorobenzenesulfonyl chloride (CAS 1208074-71-8) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 2-chloro-3,6-difluorobenzenesulfonyl chloride. InChIKey: XIBTVVMBHTYRAL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2F2O2S
Molecular weight247.05 g/mol
IUPAC name2-chloro-3,6-difluorobenzenesulfonyl chloride
InChIKeyXIBTVVMBHTYRAL-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)S(=O)(=O)Cl)Cl)F

Computed by PubChem (NCBI)