Products 1208077-94-4

CAS 1208077-94-4 is the registry number for 4-Chloro-2,6-difluorobenzenesulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-chloro-2,6-difluorobenzenesulfonyl chloride (CAS 1208077-94-4) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 4-chloro-2,6-difluorobenzenesulfonyl chloride. InChIKey: GAEHZFWVPOSTFD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2F2O2S
Molecular weight247.05 g/mol
IUPAC name4-chloro-2,6-difluorobenzenesulfonyl chloride
InChIKeyGAEHZFWVPOSTFD-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)Cl

Computed by PubChem (NCBI)