Products 1208077-31-9

CAS 1208077-31-9 is the registry number for 3-Chloro-2,6-difluorobenzenesulfonyl chloride, 95%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-chloro-2,6-difluorobenzenesulfonyl chloride (CAS 1208077-31-9) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 3-chloro-2,6-difluorobenzenesulfonyl chloride. InChIKey: HKAXNMHNWLETHN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2F2O2S
Molecular weight247.05 g/mol
IUPAC name3-chloro-2,6-difluorobenzenesulfonyl chloride
InChIKeyHKAXNMHNWLETHN-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)S(=O)(=O)Cl)F)Cl

Computed by PubChem (NCBI)