Products 286932-78-3

CAS 286932-78-3 appears in our catalog under these names: 4-Chloro-2,5-difluorobenzenesulfonyl chloride, 95%, 4-Chloro-2,5-difluorobenzenesulfonylchloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.

4-chloro-2,5-difluorobenzenesulfonyl chloride (CAS 286932-78-3) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 4-chloro-2,5-difluorobenzenesulfonyl chloride. InChIKey: RONRQDJNXCXAOU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2F2O2S
Molecular weight247.05 g/mol
IUPAC name4-chloro-2,5-difluorobenzenesulfonyl chloride
InChIKeyRONRQDJNXCXAOU-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1S(=O)(=O)Cl)F)Cl)F

Computed by PubChem (NCBI)