CAS 1208077-72-8 appears in our catalog under these names: 3-Chloro-2,4-difluorobenzene-1-sulfonyl chloride, 97%, 3-Chloro-2,4-difluorobenzenesulfonyl chloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
3-chloro-2,4-difluorobenzenesulfonyl chloride (CAS 1208077-72-8) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 3-chloro-2,4-difluorobenzenesulfonyl chloride. InChIKey: LWTZUPNGXKUHOP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 3-chloro-2,4-difluorobenzenesulfonyl chloride |
| InChIKey | LWTZUPNGXKUHOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Cl)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)