Products 119-21-1
CAS 119-21-1 is the registry number for 1–Chloro–2，4–dimethoxy–5–nitrobenzene. Offered by: GLPBio. Available pack sizes: 100mg.
1-chloro-2,4-dimethoxy-5-nitrobenzene (CAS 119-21-1) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 1-chloro-2,4-dimethoxy-5-nitrobenzene. InChIKey: MEIDXJUMYYOXHN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 1-chloro-2,4-dimethoxy-5-nitrobenzene |
| InChIKey | MEIDXJUMYYOXHN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])Cl)OC |
Computed by PubChem (NCBI)
Synonyms:
1-Chloro-2,4-dimethoxy-5-nitrobenzene, 5-Chloro-2,4-dimethoxynitrobenzene, Benzene, 5-chloro-1-nitro-2,4-dimethoxy-, 4-06-00-05694 (Beilstein Handbook Reference), Benzene,1-chloro-2,4-dimethoxy-5-nitro-, Benzene,4-dimethoxy-5-nitro-, 1-chloro-2,4-dimethoxy-5-nitro-benzene, 1-Chloro-2,4-dimethoxy-5-nitrobenzene #