CAS 1154573-41-7 is the registry number for N-(5-Chlorofuran-2-carbonyl)-N-methylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(5-chlorofuran-2-carbonyl)amino]acetate (CAS 1154573-41-7) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: methyl 2-[(5-chlorofuran-2-carbonyl)amino]acetate. InChIKey: ABWGHKCLRYVBGB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | methyl 2-[(5-chlorofuran-2-carbonyl)amino]acetate |
| InChIKey | ABWGHKCLRYVBGB-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)C1=CC=C(O1)Cl |
Computed by PubChem (NCBI)