CAS 1098067-51-6 is the registry number for 2-Chloro-1,3-dimethoxy-4-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1,3-dimethoxy-4-nitrobenzene (CAS 1098067-51-6) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 2-chloro-1,3-dimethoxy-4-nitrobenzene. InChIKey: DXWGZZDXYVQOLW-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 2-chloro-1,3-dimethoxy-4-nitrobenzene |
| InChIKey | DXWGZZDXYVQOLW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])OC)Cl |
Computed by PubChem (NCBI)