cas: 677743-50-9 — see every product listed under this CAS number, including other names
2-Chloro-4-cyanophenylboronic Acid 98% (CAS 677743-50-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193191-100mg |
| cas | 677743-50-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193191 |
(2-chloro-4-cyanophenyl)boronic acid (CAS 677743-50-9) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (2-chloro-4-cyanophenyl)boronic acid. InChIKey: MSCQYLAIRMCGGF-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (2-chloro-4-cyanophenyl)boronic acid |
| InChIKey | MSCQYLAIRMCGGF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)Cl)(O)O |
Computed by PubChem (NCBI)