2-Chloro-5-cyanophenylboronic acid, 98%
cas: 936249-33-1 — see every product listed under this CAS number, including other names
2-Chloro-5-cyanophenylboronic acid, 98% (CAS 936249-33-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A635164-250mg |
| cas | 936249-33-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 676.31 Pln | |
| Ambeed | 25g | 2806.75 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 698.00 Pln | |
| Chemat | 25g | 2723.60 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 242.16 Pln | |
| BLDpharm | 5g | 725.32 Pln | |
| BLDpharm | 25g | 3018.96 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 25g | 2882.34 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-chloro-5-cyanophenyl)boronic acid (CAS 936249-33-1) is a chemical compound with the molecular formula C7H5BClNO2 and a molecular weight of 181.38 g/mol. IUPAC name: (2-chloro-5-cyanophenyl)boronic acid. InChIKey: YNZXUVCJPQNYHR-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO2 |
|---|---|
| Molecular weight | 181.38 g/mol |
| IUPAC name | (2-chloro-5-cyanophenyl)boronic acid |
| InChIKey | YNZXUVCJPQNYHR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C#N)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-5-cyanophenylboronic acid, (2-chloro-5-cyanophenyl)boronic acid, (2-chloro-5-cyano-phenyl)boronic Acid, 2-chloro-5-cyanobenzeneboronic acid, 2-Chloro-5-cyanophenylboronicacid, [2-Chloro-5-cyanophenyl]boronic acid, YNZXUVCJPQNYHR-UHFFFAOYSA-N, 2-chloro-5-cyanophenyl boronic acid, [6-Chloro-3-cyanophenyl]boronic acid, B-(2-Chloro-5-cyanophenyl)boronic acid