2-Chloro-5-methylbenzene-1-sulfonyl chloride, 95%
cas: 99876-69-4 — see every product listed under this CAS number, including other names
2-Chloro-5-methylbenzene-1-sulfonyl chloride, 95% (CAS 99876-69-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1028373-100mg |
| cas | 99876-69-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2217.12 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 886.38 Pln | |
| BLDpharm | 5g | 2385.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-methylbenzenesulfonyl chloride (CAS 99876-69-4) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 2-chloro-5-methylbenzenesulfonyl chloride. InChIKey: IJUVBGAZPUZWJR-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 2-chloro-5-methylbenzenesulfonyl chloride |
| InChIKey | IJUVBGAZPUZWJR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
