Products 99876-69-4
CAS 99876-69-4 appears in our catalog under these names: 2-Chloro-5-methylbenzene-1-sulfonyl chloride, 98%, 2-Chloro-5-methylbenzene-1-sulfonyl chloride, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g.
2-chloro-5-methylbenzenesulfonyl chloride (CAS 99876-69-4) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 2-chloro-5-methylbenzenesulfonyl chloride. InChIKey: IJUVBGAZPUZWJR-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 2-chloro-5-methylbenzenesulfonyl chloride |
| InChIKey | IJUVBGAZPUZWJR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)