2-Chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine, 97%
cas: 2089300-75-2 — see every product listed under this CAS number, including other names
2-Chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine, 97% (CAS 2089300-75-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A189869-250mg |
| cas | 2089300-75-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2389.56 Pln | |
| Ambeed | 1g | 7028.69 Pln | |
| Ambeed | 5g | 27904.75 Pln | |
| Chemat | 50mg | 760.40 Pln | |
| Chemat | 100mg | 1230.80 Pln | |
| Chemat | 250mg | 2397.20 Pln | |
| Chemat | 1g | 7067.60 Pln | |
| Chemat | 5g | 28072.40 Pln | |
| BLDpharm | 50mg | 819.74 Pln | |
| BLDpharm | 100mg | 1319.56 Pln | |
| BLDpharm | 250mg | 2569.12 Pln | |
| BLDpharm | 1g | 7572.91 Pln | |
| BLDpharm | 5g | 30081.65 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine (CAS 2089300-75-2) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 2-chloro-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine. InChIKey: HMDODBSSYDBRGX-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 2-chloro-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine |
| InChIKey | HMDODBSSYDBRGX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=NC(=CN=C32)Cl |
Computed by PubChem (NCBI)