Products 56176-07-9

CAS 56176-07-9 is the registry number for Torasemide Impurity 31. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-(4-chlorophenyl)-3-methylpyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide (CAS 56176-07-9) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 4-(4-chlorophenyl)-3-methylpyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide. InChIKey: PTBIJGYLLOEXDP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClN3O2S
Molecular weight307.76 g/mol
IUPAC name4-(4-chlorophenyl)-3-methylpyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide
InChIKeyPTBIJGYLLOEXDP-UHFFFAOYSA-N
SMILESCC1=NS(=O)(=O)C2=C(N1C3=CC=C(C=C3)Cl)C=CN=C2

Computed by PubChem (NCBI)