Products 2089300-75-2
CAS 2089300-75-2 appears in our catalog under these names: 2-Chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine, 97%, 97%, 2-Chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 250mg, 1g, 5g.
2-chloro-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine (CAS 2089300-75-2) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 2-chloro-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine. InChIKey: HMDODBSSYDBRGX-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 2-chloro-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine |
| InChIKey | HMDODBSSYDBRGX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=NC(=CN=C32)Cl |
Computed by PubChem (NCBI)