Products 1694666-73-3
CAS 1694666-73-3 appears in our catalog under these names: 2-Chloro-7-tosyl-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97%, 2-chloro-7-(p-tolylsulfonyl)pyrrolo[2,3-d]pyrimidine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
2-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine (CAS 1694666-73-3) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 2-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine. InChIKey: MICPVGATHNRMKH-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 2-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine |
| InChIKey | MICPVGATHNRMKH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CN=C(N=C32)Cl |
Computed by PubChem (NCBI)