CAS 1311275-32-7 is the registry number for 4-Chloro-5-tosyl-5H-pyrrolo(3,2-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-5-(4-methylphenyl)sulfonylpyrrolo[3,2-d]pyrimidine (CAS 1311275-32-7) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 4-chloro-5-(4-methylphenyl)sulfonylpyrrolo[3,2-d]pyrimidine. InChIKey: VSFDYYLYTLVJCC-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 4-chloro-5-(4-methylphenyl)sulfonylpyrrolo[3,2-d]pyrimidine |
| InChIKey | VSFDYYLYTLVJCC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)