Products 1909317-31-2
CAS 1909317-31-2 is the registry number for 3-Methyl-1-phenyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1909317-31-2) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: DVIFUBNCZGWRES-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | DVIFUBNCZGWRES-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)S(=O)(=O)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)