CAS 479633-63-1 appears in our catalog under these names: 4-Chloro-7-tosyl-7h-pyrrolo[2,3-d]pyrimidine, 98%, Tofacitinib Impurity 107, Tofacitinib Impurity 9, 4-Chloro-7-tosyl-7H-pyrrolo(2,3-d)pyrimidine, >95% (HPLC), 4–Chloro–7–tosyl–7H–pyrrolo(2,3–d)pyrimidine. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TCI. Available pack sizes: 25g, 500g, 5g, 100g, 1g, on request, 1000g, 10g.
4-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine (CAS 479633-63-1) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 4-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine. InChIKey: BTOJSYRZQZOMOK-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 4-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine |
| InChIKey | BTOJSYRZQZOMOK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=CN=C3Cl |
Computed by PubChem (NCBI)