CAS 252723-16-3 is the registry number for 7–Benzenesulfonyl–4–chloro–6–methyl–7H–pyrrolo(2,3–d)pyrimidine. Offered by: GLPBio. Available pack sizes: 1g.
7-(benzenesulfonyl)-4-chloro-6-methylpyrrolo[2,3-d]pyrimidine (CAS 252723-16-3) is a chemical compound with the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. IUPAC name: 7-(benzenesulfonyl)-4-chloro-6-methylpyrrolo[2,3-d]pyrimidine. InChIKey: QSIDTDGOKALJNU-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2S |
|---|---|
| Molecular weight | 307.76 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-4-chloro-6-methylpyrrolo[2,3-d]pyrimidine |
| InChIKey | QSIDTDGOKALJNU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1S(=O)(=O)C3=CC=CC=C3)N=CN=C2Cl |
Computed by PubChem (NCBI)