cas: 79455-63-3 — see every product listed under this CAS number, including other names
2-Chloro-6-fluorobenzoyl chloride 98% (CAS 79455-63-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A378072-1g |
| cas | 79455-63-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 25g | 448.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A378072 |
2-chloro-6-fluorobenzoyl chloride (CAS 79455-63-3) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-6-fluorobenzoyl chloride. InChIKey: GFNAJZAKJGKJCS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-6-fluorobenzoyl chloride |
| InChIKey | GFNAJZAKJGKJCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)