cas: 40759-45-3 — see every product listed under this CAS number, including other names
2-Chlorophenethyl methanesulfonate, 97% (CAS 40759-45-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A321749-5g |
| cas | 40759-45-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8533.00 Pln | |
| AmBeed | 25g | 25543.63 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-chlorophenyl)ethyl methanesulfonate (CAS 40759-45-3) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 2-(2-chlorophenyl)ethyl methanesulfonate. InChIKey: ZNHIBZIUMHTTKD-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-(2-chlorophenyl)ethyl methanesulfonate |
| InChIKey | ZNHIBZIUMHTTKD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)