2-Chloroterephthalic acid, 98%
cas: 1967-31-3 — see every product listed under this CAS number, including other names
2-Chloroterephthalic acid, 98% (CAS 1967-31-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A489536-250mg |
| cas | 1967-31-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 549.20 Pln | |
| Chemat | 25g | 2219.60 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 281.04 Pln | |
| BLDpharm | 5g | 1086.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-chloroterephthalic acid (CAS 1967-31-3) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 2-chloroterephthalic acid. InChIKey: ZPXGNBIFHQKREO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 2-chloroterephthalic acid |
| InChIKey | ZPXGNBIFHQKREO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloroterephthalic acid, 2-chloro-1,4-benzenedicarboxylic acid, 2-chlorobenzene-1,4-dicarboxylic acid, 1,4-Benzenedicarboxylic acid, 2-chloro-, 2-Chloroterephthalicacid, 2-chloro terephthalic acid, 2-Chlorobenzene-1,4-dioic acid, Terephthalic acid, chloro-, chloroterephthalic acid, 2-C2-Chloroterephthalic Acid