Products 855641-85-9
CAS 855641-85-9 is the registry number for 3-Chloro-5-formyl-4-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 2g, 1g.
3-chloro-5-formyl-4-hydroxybenzoic acid (CAS 855641-85-9) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 3-chloro-5-formyl-4-hydroxybenzoic acid. InChIKey: NPSZSOAZDRETTJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 3-chloro-5-formyl-4-hydroxybenzoic acid |
| InChIKey | NPSZSOAZDRETTJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-5-formyl-4-hydroxybenzoic acid