CAS 22519-35-3 appears in our catalog under these names: 7-Chloro-2H-1,3-benzodioxole-5-carboxylic acid, 95%, 7-Chloro-2H-1,3-benzodioxole-5-carboxylic acid, 97%, 97%, 7-Chloro-1,3-dioxaindane-5-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
7-chloro-1,3-benzodioxole-5-carboxylic acid (CAS 22519-35-3) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 7-chloro-1,3-benzodioxole-5-carboxylic acid. InChIKey: LAERQWJVFGZZHL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 7-chloro-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | LAERQWJVFGZZHL-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)