Products 2157-39-3
CAS 2157-39-3 appears in our catalog under these names: 5-Chloroisophthalic acid, 98%, 5–Chloroisophthalic Acid, 5-Chloroisophthalic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 250mg.
5-chlorobenzene-1,3-dicarboxylic acid (CAS 2157-39-3) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 5-chlorobenzene-1,3-dicarboxylic acid. InChIKey: PLPFTLXIQQYOMW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 5-chlorobenzene-1,3-dicarboxylic acid |
| InChIKey | PLPFTLXIQQYOMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)