CAS 117886-89-2 appears in our catalog under these names: Benzo[d][1,3]dioxol-5-yl carbonochloridate, 95%, Benzo(d)(1,3)dioxol–5–yl carbonochloridate, Benzo[d][1,3]dioxol-5-yl carbonochloridate 95%, Benzo[d][1,3]dioxol-5-yl carbonochloridate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 100mg.
1,3-benzodioxol-5-yl carbonochloridate (CAS 117886-89-2) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 1,3-benzodioxol-5-yl carbonochloridate. InChIKey: DTGXWXVOKIDGIE-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl carbonochloridate |
| InChIKey | DTGXWXVOKIDGIE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OC(=O)Cl |
Computed by PubChem (NCBI)